B3DB_classification_index
string | compound_name
string | IUPAC_name
string | SMILES
string | CID
float64 | logBB
float64 | Y
int64 | Inchi
string | threshold
float64 | reference
string | group
string | comments
string | ClusterNo
int64 | MolCount
int64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
B3DB_classification_1
|
sulphasalazine
|
2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid
|
O=C(O)c1cc(N=Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O
| 5,339 | -2.69 | 0 |
InChI=1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,23H,(H,19,22)(H,24,25)
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_23
|
raloxifene
|
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone
|
O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12
| 5,035 | -1.81 | 0 |
InChI=1S/C28H27NO4S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_25
|
chlorambucil
|
4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid
|
O=C(O)CCCc1ccc(N(CCCl)CCCl)cc1
| 2,708 | -1.7 | 0 |
InChI=1S/C14H19Cl2NO2/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19/h4-7H,1-3,8-11H2,(H,18,19)
| null |
R18|R26|R27|R2|R2|R5|R8|R17|R21|R25|R27|R27|R35|R36|R39|R43|R46|R47|R49|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_28
|
flurbiprofen
|
2-(3-fluoro-4-phenylphenyl)propanoic acid
|
CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1
| 3,394 | -1.68 | 0 |
InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)
| null |
R2|R2|R18|R20|R25|R26|R27|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_30
|
d-mannitol
|
(2r,3r,4r,5r)-hexane-1,2,3,4,5,6-hexol
|
OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
| 6,251 | -1.6 | 0 |
InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1
| null |
R31|R8|R21|
|
training
| null | 1 | 2,208 |
B3DB_classification_31
|
mannitol (d-mannitol)
|
hexane-1,2,3,4,5,6-hexol
|
OCC(O)C(O)C(O)C(O)CO
| 453 | -1.6 | 0 |
InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2
| null |
R2|R2|R3|R18|R25|R26|R27|R27|R38|R40|R41|R43|R46|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_32
|
compound 34
|
n-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]acetamide
|
CC(=O)Nc1cccc(-c2csc(N=C(N)N)n2)c1
| 14,022,511 | -1.57 | 0 |
InChI=1S/C12H13N5OS/c1-7(18)15-9-4-2-3-8(5-9)10-6-19-12(16-10)17-11(13)14/h2-6H,1H3,(H,15,18)(H4,13,14,16,17)
| null |
R2|R2|R8|R40|R3|R3|R12|R18|R25|R26|R27|R35|R36|R38|R38|R41|R41|R43|R46|R47|R48|R49|R49|R4|
|
training
| null | 1 | 2,208 |
B3DB_classification_35
|
chebi: 145922
|
1-cyano-3-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-2-methylguanidine
|
CN=C(NC#N)Nc1cccc(-c2csc(N=C(N)N)n2)c1
| 14,022,519 | -1.54 | 0 |
InChI=1S/C13H14N8S/c1-17-12(18-7-14)19-9-4-2-3-8(5-9)10-6-22-13(20-10)21-11(15)16/h2-6H,1H3,(H2,17,18,19)(H4,15,16,20,21)
| null |
R2|R2|R2|R2|R3|R3|R8|R12|R18|R21|R25|R25|R26|R27|R27|R35|R36|R38|R38|R40|R41|R41|R43|R46|R46|R47|R48|R49|R4|R41|
|
training
| null | 1 | 2,208 |
B3DB_classification_36
|
guanidinothiazol analogue 17 ac1lbibi -- pubmed
|
2-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]guanidine
|
NC(N)=Nc1nc(-c2ccc(O)c(O)c2)cs1
| 536,278 | -1.54 | 0 |
InChI=1S/C10H10N4O2S/c11-9(12)14-10-13-6(4-17-10)5-1-2-7(15)8(16)3-5/h1-4,15-16H,(H4,11,12,13,14)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_40
|
chembl151192
|
n-[2-[4-[3-(ethylamino)pyridin-2-yl]piperazine-1-carbonyl]-1h-indol-5-yl]methanesulfonamide
|
CCNc1cccnc1N1CCN(C(=O)c2cc3cc(NS(C)(=O)=O)ccc3[nH]2)CC1
| 468,305 | -1.52 | 0 |
InChI=1S/C21H26N6O3S/c1-3-22-18-5-4-8-23-20(18)26-9-11-27(12-10-26)21(28)19-14-15-13-16(25-31(2,29)30)6-7-17(15)24-19/h4-8,13-14,22,24-25H,3,9-12H2,1-2H3
| null |
R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_43
|
baclofen
|
4-amino-3-(4-chlorophenyl)butanoic acid
|
NCC(CC(=O)O)c1ccc(Cl)cc1
| 2,284 | -1.52 | 0 |
InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_46
|
imatinib
|
4-[(4-methylpiperazin-1-yl)methyl]-n-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide
|
Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1
| 5,291 | -1.5 | 0 |
InChI=1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_49
|
4-hydroxyalprazolam
|
8-chloro-1-methyl-6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-ol
|
Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2O
| 182,017 | -1.48 | 0 |
InChI=1S/C17H13ClN4O/c1-10-20-21-16-17(23)19-15(11-5-3-2-4-6-11)13-9-12(18)7-8-14(13)22(10)16/h2-9,17,23H,1H3
| null |
R2|R2|R8|R12|R21|R25|R27|R40|R43|R46|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_51
|
atenolol
| null |
CC(C)NC(O)COc1ccc(CC(N)=O)cc1
| null | -1.42 | 0 |
InChI=1S/C13H20N2O3/c1-9(2)15-13(17)8-18-11-5-3-10(4-6-11)7-12(14)16/h3-6,9,13,15,17H,7-8H2,1-2H3,(H2,14,16)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_61
|
4-aminobenzoic acid
|
4-aminobenzoic acid
|
Nc1ccc(C(=O)O)cc1
| 978 | -1.4 | 0 |
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_62
| null | null |
CCOc1ccc(C(=O)c2cccc3ccccc23)c2ccccc12
| null | -1.39 | 0 |
InChI=1S/C23H18O2/c1-2-25-22-15-14-21(18-11-5-6-12-19(18)22)23(24)20-13-7-9-16-8-3-4-10-17(16)20/h3-15H,2H2,1H3
| null |
R2|R2|R25|R27|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_66
|
benzoylecgonine
| null |
CN1[C@H]2CC[C@H]1[C@@H](CC(=O)O)[C@@H](OC(=O)c1ccccc1)C2
| null | -1.35 | 0 |
InChI=1S/C17H21NO4/c1-18-12-7-8-14(18)13(10-16(19)20)15(9-12)22-17(21)11-5-3-2-4-6-11/h2-6,12-15H,7-10H2,1H3,(H,19,20)/t12-,13+,14-,15-/m0/s1
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_68
|
dcka
|
5,7-dichloro-4-oxo-1h-quinoline-2-carboxylic acid
|
O=C(O)c1cc(=O)c2c(Cl)cc(Cl)cc2[nH]1
| 1,779 | -1.33 | 0 |
InChI=1S/C10H5Cl2NO3/c11-4-1-5(12)9-6(2-4)13-7(10(15)16)3-8(9)14/h1-3H,(H,13,14)(H,15,16)
| null |
R20|
|
training
| null | 1 | 2,208 |
B3DB_classification_70
|
salbutamol
|
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol
|
CC(C)(C)NCC(O)c1ccc(O)c(CO)c1
| 2,083 | -1.3 | 0 |
InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3
| null |
R3|R18|R25|R26|R27|R38|R41|R46|R47|R2|R2|R27|R40|R8|R21|R27|R43|R12|R31|R35|R39|R5|
|
training
| null | 1 | 2,208 |
B3DB_classification_81
|
yg19
|
2-(4-phenyl-1,3-thiazol-2-yl)ethanamine
|
NCCc1nc(-c2ccccc2)cs1
| 1,497,794 | -1.3 | 0 |
InChI=1S/C11H12N2S/c12-7-6-11-13-10(8-14-11)9-4-2-1-3-5-9/h1-5,8H,6-7,12H2
| null |
R35|R36|R43|R48|R49|R4|R8|R21|R27|R2|R2|R12|R25|R46|R48|
|
training
| null | 1 | 2,208 |
B3DB_classification_83
|
diclofenac
|
2-[2-(2,6-dichloroanilino)phenyl]acetic acid
|
O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl
| 3,033 | -1.3 | 0 |
InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_86
|
Ξ±-hydroxyalprazolam (alpha-hydroxyalprazolam)
|
(8-chloro-6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methanol
|
OCc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2
| 162,244 | -1.3 | 0 |
InChI=1S/C17H13ClN4O/c18-12-6-7-14-13(8-12)17(11-4-2-1-3-5-11)19-9-15-20-21-16(10-23)22(14)15/h1-8,23H,9-10H2
| null |
R5|R8|R21|R27|R2|R2|R12|R25|R35|R40|R46|R47|R43|
|
training
| null | 1 | 2,208 |
B3DB_classification_89
|
p-phenylbenzoic acid
|
4-phenylbenzoic acid
|
O=C(O)c1ccc(-c2ccccc2)cc1
| 66,724 | -1.26 | 0 |
InChI=1S/C13H10O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,14,15)
| null |
R2|R2|R8|R21|R25|R27|R41|R43|R46|R47|R40|R3|R38|
|
training
| null | 1 | 2,208 |
B3DB_classification_103
|
bufotenine
|
3-[2-(dimethylamino)ethyl]-1h-indol-5-ol
|
CN(C)CCc1c[nH]c2ccc(O)cc12
| 10,257 | -1.19 | 0 |
InChI=1S/C12H16N2O/c1-14(2)6-5-9-8-13-12-4-3-10(15)7-11(9)12/h3-4,7-8,13,15H,5-6H2,1-2H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_104
|
y12
|
[2-acetyloxy-4-[(e)-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenyl] acetate
|
CC(=O)Oc1ccc(/C=C/C(=O)NCCc2ccccc2)cc1OC(C)=O
| 11,957,394 | -1.17 | 0 |
InChI=1S/C21H21NO5/c1-15(23)26-19-10-8-18(14-20(19)27-16(2)24)9-11-21(25)22-13-12-17-6-4-3-5-7-17/h3-11,14H,12-13H2,1-2H3,(H,22,25)/b11-9+
| null |
R11|
|
training
| null | 1 | 2,208 |
B3DB_classification_106
|
72801-60-6
|
2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine
|
NC(N)=Nc1nc(-c2cccc(N)c2)cs1
| 14,022,509 | -1.15 | 0 |
InChI=1S/C10H11N5S/c11-7-3-1-2-6(4-7)8-5-16-10(14-8)15-9(12)13/h1-5H,11H2,(H4,12,13,14,15)
| null |
R18|R26|R27|R4|R2|R2|R3|R3|R8|R12|R21|R25|R27|R35|R36|R38|R40|R41|R43|R46|R47|R48|R49|R49|
|
training
| null | 1 | 2,208 |
B3DB_classification_114
|
sulpiride
|
n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide
|
CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC
| 5,355 | -1.11 | 0 |
InChI=1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_115
|
salicylic acid (2-hydroxybenzoic acid)
|
2-hydroxybenzoic acid
|
O=C(O)c1ccccc1O
| 338 | -1.1 | 0 |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)
| null |
R3|R41|R38|R40|R50|R8|R21|R27|R2|R2|R27|R3|R5|R11|R12|R17|R18|R25|R26|R27|R35|R36|R39|R43|R46|R47|R48|R49|R49|R4|R31|
|
training
| null | 1 | 2,208 |
B3DB_classification_124
|
zolmitriptan
|
(4s)-4-[[3-[2-(dimethylamino)ethyl]-1h-indol-5-yl]methyl]-1,3-oxazolidin-2-one
|
CN(C)CCc1c[nH]c2ccc(C[C@H]3COC(=O)N3)cc12
| 60,857 | -1.04 | 0 |
InChI=1S/C16H21N3O2/c1-19(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-21-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20)/t13-/m0/s1
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_128
|
139264-82-7
|
4-[[3-[2-(dimethylamino)ethyl]-1h-indol-5-yl]methyl]-1,3-oxazolidin-2-one
|
CN(C)CCc1c[nH]c2ccc(CC3COC(=O)N3)cc12
| 5,731 | -1.01 | 0 |
InChI=1S/C16H21N3O2/c1-19(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-21-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_129
|
fexofenadine (allegra)
|
2-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoic acid
|
CC(C)(C(=O)O)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1
| 3,348 | -1 | 1 |
InChI=1S/C32H39NO4/c1-31(2,30(35)36)25-17-15-24(16-18-25)29(34)14-9-21-33-22-19-28(20-23-33)32(37,26-10-5-3-6-11-26)27-12-7-4-8-13-27/h3-8,10-13,15-18,28-29,34,37H,9,14,19-23H2,1-2H3,(H,35,36)
| null |
R18|R26|R27|R2|R2|R8|R40|R4|R21|R25|R27|R46|R50|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_130
|
proc-19m
| null |
CC(C)(C)c1ccc(C(=O)N2CCN(c3ccc(OCCCN4CCCCC4)cc3)C(=O)C2)cc1
| null | -1 | 1 |
InChI=1S/C29H39N3O3/c1-29(2,3)24-10-8-23(9-11-24)28(34)31-19-20-32(27(33)22-31)25-12-14-26(15-13-25)35-21-7-18-30-16-5-4-6-17-30/h8-15H,4-7,16-22H2,1-3H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_142
|
chembl3264225
|
(e)-3-[3,4-bis(2-hydroxyethoxy)phenyl]-n-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide
|
Cc1cc2ccccc2n1CCNC(=O)/C=C/c1ccc(OCCO)c(OCCO)c1
| 86,765,134 | -1 | 1 |
InChI=1S/C24H28N2O5/c1-18-16-20-4-2-3-5-21(20)26(18)11-10-25-24(29)9-7-19-6-8-22(30-14-12-27)23(17-19)31-15-13-28/h2-9,16-17,27-28H,10-15H2,1H3,(H,25,29)/b9-7+
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_146
|
chembl1185227
|
4-[4-(azetidine-1-carbonyl)benzoyl]-1-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]piperazin-2-one
|
O=C(c1ccc(C(=O)N2CCN(c3ccc(OC4CCN(C5CCC5)CC4)cc3)C(=O)C2)cc1)N1CCC1
| 15,986,375 | -1 | 1 |
InChI=1S/C30H36N4O4/c35-28-21-33(30(37)23-7-5-22(6-8-23)29(36)32-15-2-16-32)19-20-34(28)25-9-11-26(12-10-25)38-27-13-17-31(18-14-27)24-3-1-4-24/h5-12,24,27H,1-4,13-21H2
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_149
|
anabet
|
5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol
|
CC(C)(C)NCC(O)COc1cccc2c1CC(O)C(O)C2
| 4,411 | -0.95 | 1 |
InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_154
|
chembl243790
|
6-(4-ethylsulfonylphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol
|
CCS(=O)(=O)c1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1
| 10,324,755 | -0.92 | 1 |
InChI=1S/C31H33NO5S/c1-2-38(34,35)28-14-6-23(7-15-28)29-16-8-24-22-25(33)9-17-30(24)31(29)37-27-12-10-26(11-13-27)36-21-20-32-18-4-3-5-19-32/h6-17,22,33H,2-5,18-21H2,1H3
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_155
|
atenolol
|
2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide
|
CC(C)NCC(O)COc1ccc(CC(N)=O)cc1
| 2,249 | -0.9 | 1 |
InChI=1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18)
| null |
R36|R43|R47|R5|R8|R21|R27|R4|R40|R50|R2|R2|R27|R12|R31|R35|R39|R46|R25|R41|R3|R38|R44|
|
training
| null | 1 | 2,208 |
B3DB_classification_157
|
glibenclamide
|
5-chloro-n-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxybenzamide
|
COc1ccc(Cl)cc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1
| 3,488 | -0.9 | 1 |
InChI=1S/C23H28ClN3O5S/c1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/h7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29)
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_165
|
sulfamethoxypyridazine
|
4-amino-n-(6-methoxypyridazin-3-yl)benzenesulfonamide
|
COc1ccc(NS(=O)(=O)c2ccc(N)cc2)nn1
| 5,330 | -0.85 | 1 |
InChI=1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_167
|
chembl357268
|
benzyl n-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate
|
Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2ccccc2)cc1
| 5,044 | -0.85 | 1 |
InChI=1S/C22H21N3O3/c23-19-8-4-5-9-20(19)25-21(26)18-12-10-16(11-13-18)14-24-22(27)28-15-17-6-2-1-3-7-17/h1-13H,14-15,23H2,(H,24,27)(H,25,26)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_171
|
ly2066948
|
6-(4-methylsulfonylphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol
|
CS(=O)(=O)c1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1
| 5,327,043 | -0.81 | 1 |
InChI=1S/C30H31NO5S/c1-37(33,34)27-13-5-22(6-14-27)28-15-7-23-21-24(32)8-16-29(23)30(28)36-26-11-9-25(10-12-26)35-20-19-31-17-3-2-4-18-31/h5-16,21,32H,2-4,17-20H2,1H3
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_172
|
domperidone
|
6-chloro-3-[1-[3-(2-oxo-3h-benzimidazol-1-yl)propyl]piperidin-4-yl]-1h-benzimidazol-2-one
|
O=c1[nH]c2ccccc2n1CCCN1CCC(n2c(=O)[nH]c3cc(Cl)ccc32)CC1
| 3,151 | -0.8 | 1 |
InChI=1S/C22H24ClN5O2/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30)
| null |
R27|R47|R3|R18|R26|R38|R41|R40|R8|R21|R27|R2|R2|R5|R25|R36|R39|R46|R49|
|
training
| null | 1 | 2,208 |
B3DB_classification_177
|
compound 4b [pmid: 16099654]
|
n-(2-ethyltetrazol-5-yl)-9h-xanthene-9-carboxamide
|
CCn1nnc(NC(=O)C2c3ccccc3Oc3ccccc32)n1
| 9,923,127 | -0.8 | 1 |
InChI=1S/C17H15N5O2/c1-2-22-20-17(19-21-22)18-16(23)15-11-7-3-5-9-13(11)24-14-10-6-4-8-12(14)15/h3-10,15H,2H2,1H3,(H,18,20,23)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_178
|
compound 13
|
2-[[5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]amino]-n,n-dimethylbenzenesulfonamide
|
CN1CCN(Cc2ccc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)N(C)C)n3)cc2)CC1
| 56,839,178 | -0.8 | 1 |
InChI=1S/C24H30ClN7O2S/c1-30(2)35(33,34)22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29)
| null |
R20|
|
training
| null | 1 | 2,208 |
B3DB_classification_180
|
risperidone-9-oh
| null |
Cc1nc2n(c(=O)c1CCN1CCC(c3coc4cc(F)ccc34)CC1)CCCC2O
| null | -0.8 | 1 |
InChI=1S/C24H28FN3O3/c1-15-18(24(30)28-9-2-3-21(29)23(28)26-15)8-12-27-10-6-16(7-11-27)20-14-31-22-13-17(25)4-5-19(20)22/h4-5,13-14,16,21,29H,2-3,6-12H2,1H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_181
|
levodopa
|
(2s)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid
|
N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O
| 6,047 | -0.8 | 1 |
InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1
| null |
R5|R21|R8|R39|
|
training
| null | 1 | 2,208 |
B3DB_classification_182
|
d-phenylalanine-l-proline
| null |
N[C@H](Cc1ccccc1)C(=O)ON1CCC[C@H]1C(=O)O
| null | -0.8 | 1 |
InChI=1S/C14H18N2O4/c15-11(9-10-5-2-1-3-6-10)14(19)20-16-8-4-7-12(16)13(17)18/h1-3,5-6,11-12H,4,7-9,15H2,(H,17,18)/t11-,12+/m1/s1
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_191
|
n-methylthiazolium-dcka
| null |
Cc1c(CCOC(=O)c2cc(=O)c3c(Cl)cc(Cl)cc3[nH]2)sc[n+]1C
| null | -0.78 | 1 |
InChI=1S/C17H14Cl2N2O3S/c1-9-15(25-8-21(9)2)3-4-24-17(23)13-7-14(22)16-11(19)5-10(18)6-12(16)20-13/h5-8H,3-4H2,1-2H3/p+1
| null |
R2|R2|R20|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_192
|
levodopa
|
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid
|
NC(Cc1ccc(O)c(O)c1)C(=O)O
| 836 | -0.77 | 1 |
InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)
| null |
R27|R43|R2|R2|R12|R25|R35|R46|R47|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_193
|
chembl244000
|
6-(4-hydroxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol
|
Oc1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1
| 9,848,501 | -0.77 | 1 |
InChI=1S/C29H29NO4/c31-23-7-4-21(5-8-23)27-14-6-22-20-24(32)9-15-28(22)29(27)34-26-12-10-25(11-13-26)33-19-18-30-16-2-1-3-17-30/h4-15,20,31-32H,1-3,16-19H2
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_205
|
alfentanil, rapifen
| null |
CCCC(=O)N(c1ccccc1)C1(COC)CCN(CCn2nnn(CC)c2=O)CC1
| null | -0.71 | 1 |
InChI=1S/C22H34N6O3/c1-4-9-20(29)28(19-10-7-6-8-11-19)22(18-31-3)12-14-25(15-13-22)16-17-27-21(30)26(5-2)23-24-27/h6-8,10-11H,4-5,9,12-18H2,1-3H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_215
|
verapamil
|
2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile
|
COc1ccc(CCN(C)CCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC
| 2,520 | -0.7 | 1 |
InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3
| null |
R3|R5|R11|R12|R17|R25|R35|R36|R43|R46|R47|R49|R49|R2|R2|R27|R21|R27|R8|R50|R40|R41|R38|R18|R26|R27|R3|
|
training
| null | 1 | 2,208 |
B3DB_classification_216
|
dexverapamil
|
(2r)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile
|
COc1ccc(CCN(C)CCC[C@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC
| 65,808 | -0.7 | 1 |
InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/t27-/m1/s1
| null |
R48|
|
training
| null | 1 | 2,208 |
B3DB_classification_217
|
chembl239099
|
4-[4-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-3-oxopiperazine-1-carbonyl]benzonitrile
|
N#Cc1ccc(C(=O)N2CCN(c3ccc(OC4CCN(C5CCC5)CC4)cc3)C(=O)C2)cc1
| 15,987,108 | -0.7 | 1 |
InChI=1S/C27H30N4O3/c28-18-20-4-6-21(7-5-20)27(33)30-16-17-31(26(32)19-30)23-8-10-24(11-9-23)34-25-12-14-29(15-13-25)22-2-1-3-22/h4-11,22,25H,1-3,12-17,19H2
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_218
|
paliperidone
|
3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
|
Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2O
| 115,237 | -0.7 | 1 |
InChI=1S/C23H27FN4O3/c1-14-17(23(30)28-9-2-3-19(29)22(28)25-14)8-12-27-10-6-15(7-11-27)21-18-5-4-16(24)13-20(18)31-26-21/h4-5,13,15,19,29H,2-3,6-12H2,1H3
| null |
R2|R2|R8|R3|R12|R21|R25|R27|R36|R38|R39|R41|R43|R46|R47|R49|R20|
|
training
| null | 1 | 2,208 |
B3DB_classification_219
|
granisetron
|
1-methyl-n-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indazole-3-carboxamide
|
CN1C2CCCC1CC(NC(=O)c1nn(C)c3ccccc13)C2
| 3,510 | -0.69 | 1 |
InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)
| null |
R2|R2|R8|R21|R25|R27|R43|R46|R47|R36|
|
training
| null | 1 | 2,208 |
B3DB_classification_222
|
7-hydroxy risperidone
|
3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-7-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
|
Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CC(O)CC2
| 475,100 | -0.67 | 1 |
InChI=1S/C23H27FN4O3/c1-14-18(23(30)28-13-17(29)3-5-21(28)25-14)8-11-27-9-6-15(7-10-27)22-19-4-2-16(24)12-20(19)31-26-22/h2,4,12,15,17,29H,3,5-11,13H2,1H3
| null |
R2|R2|R8|R40|R21|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_239
|
norverapamil
|
2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-propan-2-ylpentanenitrile
|
COc1ccc(CCNCCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC
| 104,972 | -0.64 | 1 |
InChI=1S/C26H36N2O4/c1-19(2)26(18-27,21-9-11-23(30-4)25(17-21)32-6)13-7-14-28-15-12-20-8-10-22(29-3)24(16-20)31-5/h8-11,16-17,19,28H,7,12-15H2,1-6H3
| null |
R12|R21|R25|R27|R43|R46|R47|R2|R2|R8|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_242
| null | null |
CC(=O)Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1
| null | -0.62 | 1 |
InChI=1S/C20H18N2O2S/c1-13(23)11-14-4-6-15(7-5-14)20(24)22-18-12-16(8-9-17(18)21)19-3-2-10-25-19/h2-10,12H,11,21H2,1H3,(H,22,24)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_249
|
chembl239299
|
4-(2,4-difluorobenzoyl)-1-[4-[3-[(2r)-2-methylpyrrolidin-1-yl]propoxy]phenyl]piperazin-2-one
|
C[C@@H]1CCCN1CCCOc1ccc(N2CCN(C(=O)c3ccc(F)cc3F)CC2=O)cc1
| 12,001,199 | -0.6 | 1 |
InChI=1S/C25H29F2N3O3/c1-18-4-2-11-28(18)12-3-15-33-21-8-6-20(7-9-21)30-14-13-29(17-24(30)31)25(32)22-10-5-19(26)16-23(22)27/h5-10,16,18H,2-4,11-15,17H2,1H3/t18-/m1/s1
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_253
|
s-licarbizine
|
5-hydroxy-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide
|
NC(=O)N1c2ccccc2CC(O)c2ccccc21
| 114,709 | -0.59 | 1 |
InChI=1S/C15H14N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8,14,18H,9H2,(H2,16,19)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_255
|
tacedinaline
|
4-acetamido-n-(2-aminophenyl)benzamide
|
CC(=O)Nc1ccc(C(=O)Nc2ccccc2N)cc1
| 2,746 | -0.58 | 1 |
InChI=1S/C15H15N3O2/c1-10(19)17-12-8-6-11(7-9-12)15(20)18-14-5-3-2-4-13(14)16/h2-9H,16H2,1H3,(H,17,19)(H,18,20)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_256
|
tipr-dcka
| null |
C/C(=C(\CCOC(=O)c1cc(=O)c2c(Cl)cc(Cl)cc2[nH]1)SSC(C)C)N(C=O)Cc1cnc(C)nc1N
| null | -0.57 | 1 |
InChI=1S/C25H27Cl2N5O4S2/c1-13(2)37-38-22(14(3)32(12-33)11-16-10-29-15(4)30-24(16)28)5-6-36-25(35)20-9-21(34)23-18(27)7-17(26)8-19(23)31-20/h7-10,12-13H,5-6,11H2,1-4H3,(H,31,34)(H2,28,29,30)/b22-14-
| null |
R20|R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_257
|
chembl390020
|
6-(3-hydroxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol
|
Oc1cccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)c1
| 12,074,176 | -0.57 | 1 |
InChI=1S/C29H29NO4/c31-23-6-4-5-21(19-23)27-13-7-22-20-24(32)8-14-28(22)29(27)34-26-11-9-25(10-12-26)33-18-17-30-15-2-1-3-16-30/h4-14,19-20,31-32H,1-3,15-18H2
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_261
|
bmsp
|
1-(4-bromophenyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-3-methyl-1,3,8-triazaspiro[4.5]decan-4-one
|
CN1CN(c2ccc(Br)cc2)C2(CCN(CCCC(=O)c3ccc(F)cc3)CC2)C1=O
| 13,497,177 | -0.55 | 1 |
InChI=1S/C24H27BrFN3O2/c1-27-17-29(21-10-6-19(25)7-11-21)24(23(27)31)12-15-28(16-13-24)14-2-3-22(30)18-4-8-20(26)9-5-18/h4-11H,2-3,12-17H2,1H3
| null |
R40|R2|R2|R3|R25|R38|R41|R43|R46|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_262
|
practolol
|
n-[4-[(2s)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide
|
CC(=O)Nc1ccc(OC[C@@H](O)CNC(C)C)cc1
| 443,371 | -0.55 | 1 |
InChI=1S/C14H22N2O3/c1-10(2)15-8-13(18)9-19-14-6-4-12(5-7-14)16-11(3)17/h4-7,10,13,15,18H,8-9H2,1-3H3,(H,16,17)/t13-/m0/s1
| null |
R2|R2|R25|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_264
|
pregabalin
|
3-(aminomethyl)-5-methylhexanoic acid
|
CC(C)CC(CN)CC(=O)O
| 4,715,169 | -0.54 | 1 |
InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_270
|
eletriptan
|
5-[2-(benzenesulfonyl)ethyl]-3-[[(2s)-1-methylpyrrolidin-2-yl]methyl]-1h-indole
|
CN1CCC[C@H]1Cc1c[nH]c2ccc(CCS(=O)(=O)c3ccccc3)cc12
| 25,273,626 | -0.52 | 1 |
InChI=1S/C22H26N2O2S/c1-24-12-5-6-19(24)15-18-16-23-22-10-9-17(14-21(18)22)11-13-27(25,26)20-7-3-2-4-8-20/h2-4,7-10,14,16,19,23H,5-6,11-13,15H2,1H3/t19-/m0/s1
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_271
|
tg4-155
|
(e)-n-[2-(2-methylindol-1-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide
|
COc1cc(/C=C/C(=O)NCCn2c(C)cc3ccccc32)cc(OC)c1OC
| 5,886,965 | -0.52 | 1 |
InChI=1S/C23H26N2O4/c1-16-13-18-7-5-6-8-19(18)25(16)12-11-24-22(26)10-9-17-14-20(27-2)23(29-4)21(15-17)28-3/h5-10,13-15H,11-12H2,1-4H3,(H,24,26)/b10-9+
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_277
|
faha
|
6-[(2-fluoroacetyl)amino]-n-phenylhexanamide
|
O=C(CF)NCCCCCC(=O)Nc1ccccc1
| 11,995,317 | -0.51 | 1 |
InChI=1S/C14H19FN2O2/c15-11-14(19)16-10-6-2-5-9-13(18)17-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,16,19)(H,17,18)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_278
|
50-78-2
|
2-acetyloxybenzoate
|
CC(=O)Oc1ccccc1C(=O)O
| 2,244 | -0.5 | 1 |
InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)
| null |
R4|R8|R21|R27|R2|R2|R27|R5|R11|R12|R17|R18|R25|R26|R27|R35|R36|R39|R43|R46|R47|R48|R49|R49|
|
training
| null | 1 | 2,208 |
B3DB_classification_282
|
melphalan
|
2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid
|
NC(Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O
| 4,053 | -0.5 | 1 |
InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)
| null |
R2|R2|R25|R27|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_288
|
phenothiazine
|
n,n-dimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine
|
CN(C)CCCN1c2ccccc2[S+]([O-])c2ccccc21
| 547,559 | -0.48 | 1 |
InChI=1S/C17H20N2OS/c1-18(2)12-7-13-19-14-8-3-5-10-16(14)21(20)17-11-6-4-9-15(17)19/h3-6,8-11H,7,12-13H2,1-2H3
| null |
R21|R25|R27|R43|R47|R4|R2|R2|R8|R27|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_292
|
skb30 (npropylacetamide33npiperidinylmethylphenoxy)
|
n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide
|
CC(=O)NCCCOc1cccc(CN2CCCCC2)c1
| 9,971,484 | -0.46 | 1 |
InChI=1S/C17H26N2O2/c1-15(20)18-9-6-12-21-17-8-5-7-16(13-17)14-19-10-3-2-4-11-19/h5,7-8,13H,2-4,6,9-12,14H2,1H3,(H,18,20)
| null |
R2|R2|R8|R27|R40|R3|R3|R18|R21|R25|R26|R27|R27|R35|R36|R38|R38|R41|R41|R43|R46|R47|R48|R49|R49|R4|
|
training
| null | 1 | 2,208 |
B3DB_classification_294
|
naratriptan
|
n-methyl-2-[3-(1-methylpiperidin-4-yl)-1h-indol-5-yl]ethanesulfonamide
|
CNS(=O)(=O)CCc1ccc2[nH]cc(C3CCN(C)CC3)c2c1
| 4,440 | -0.46 | 1 |
InChI=1S/C17H25N3O2S/c1-18-23(21,22)10-7-13-3-4-17-15(11-13)16(12-19-17)14-5-8-20(2)9-6-14/h3-4,11-12,14,18-19H,5-10H2,1-2H3
| null |
R18|R26|R27|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_295
|
chembl239975
|
4-(4-fluorobenzoyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-2-one
|
O=C(c1ccc(F)cc1)N1CCN(c2ccc(OCCCN3CCCCC3)cc2)C(=O)C1
| 15,986,917 | -0.46 | 1 |
InChI=1S/C25H30FN3O3/c26-21-7-5-20(6-8-21)25(31)28-16-17-29(24(30)19-28)22-9-11-23(12-10-22)32-18-4-15-27-13-2-1-3-14-27/h5-12H,1-4,13-19H2
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_296
|
flesinoxan
|
4-fluoro-n-[2-[4-[2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]piperazin-1-yl]ethyl]benzamide
|
O=C(NCCN1CCN(c2cccc3c2OCC(CO)O3)CC1)c1ccc(F)cc1
| 9,844,747 | -0.45 | 1 |
InChI=1S/C22H26FN3O4/c23-17-6-4-16(5-7-17)22(28)24-8-9-25-10-12-26(13-11-25)19-2-1-3-20-21(19)29-15-18(14-27)30-20/h1-7,18,27H,8-15H2,(H,24,28)
| null |
R27|R43|R46|R47|R2|R2|R27|R25|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_297
|
flesinoxan
|
4-fluoro-n-[2-[4-[(2s)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]piperazin-1-yl]ethyl]benzamide
|
O=C(NCCN1CCN(c2cccc3c2OC[C@H](CO)O3)CC1)c1ccc(F)cc1
| 57,347 | -0.45 | 1 |
InChI=1S/C22H26FN3O4/c23-17-6-4-16(5-7-17)22(28)24-8-9-25-10-12-26(13-11-25)19-2-1-3-20-21(19)29-15-18(14-27)30-20/h1-7,18,27H,8-15H2,(H,24,28)/t18-/m0/s1
| null |
R21|R8|
|
training
| null | 1 | 2,208 |
B3DB_classification_298
|
salicyluric acid (salicylurate)
|
2-[(2-hydroxybenzoyl)amino]acetic acid
|
O=C(O)CNC(=O)c1ccccc1O
| 10,253 | -0.44 | 1 |
InChI=1S/C9H9NO4/c11-7-4-2-1-3-6(7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13)
| null |
R2|R2|R8|R11|R12|R18|R21|R25|R26|R27|R27|R27|R35|R36|R39|R43|R46|R47|R40|
|
training
| null | 1 | 2,208 |
B3DB_classification_301
|
besp
|
1-(4-bromophenyl)-3-ethyl-8-[4-(4-fluorophenyl)-4-oxobutyl]-1,3,8-triazaspiro[4.5]decan-4-one
|
CCN1CN(c2ccc(Br)cc2)C2(CCN(CCCC(=O)c3ccc(F)cc3)CC2)C1=O
| 13,497,179 | -0.43 | 1 |
InChI=1S/C25H29BrFN3O2/c1-2-29-18-30(22-11-7-20(26)8-12-22)25(24(29)32)13-16-28(17-14-25)15-3-4-23(31)19-5-9-21(27)10-6-19/h5-12H,2-4,13-18H2,1H3
| null |
R2|R2|R8|R27|R40|R3|R25|R38|R41|R43|R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_309
|
sumatriptan
|
1-[3-[2-(dimethylamino)ethyl]-1h-indol-5-yl]-n-methylmethanesulfonamide
|
CNS(=O)(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1
| 5,358 | -0.4 | 1 |
InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3
| null |
R18|R26|R27|R47|R2|R2|R25|R27|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_310
|
carteolol
|
5-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-1h-quinolin-2-one
|
CC(C)(C)NCC(O)COc1cccc2c1CCC(=O)N2
| 2,583 | -0.4 | 1 |
InChI=1S/C16H24N2O3/c1-16(2,3)17-9-11(19)10-21-14-6-4-5-13-12(14)7-8-15(20)18-13/h4-6,11,17,19H,7-10H2,1-3H3,(H,18,20)
| null |
R18|R26|R27|R40|R3|R25|R38|R41|R46|R47|R8|R21|R27|R43|
|
training
| null | 1 | 2,208 |
B3DB_classification_313
|
probenecid
|
4-(dipropylsulfamoyl)benzoic acid
|
CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1
| 4,911 | -0.4 | 1 |
InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16)
| null |
R2|R2|R25|R27|R46|
|
training
| null | 1 | 2,208 |
B3DB_classification_314
|
mesoridazine
|
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine
|
CN1CCCCC1CCN1c2ccccc2Sc2ccc([S+](C)[O-])cc21
| 4,078 | -0.4 | 1 |
InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
| null |
R5|R11|R12|R20|R25|R35|R36|R39|R43|R47|R2|R2|R27|R8|R21|R27|R40|R4|
|
training
| null | 1 | 2,208 |
B3DB_classification_315
|
compound 3a [pmid: 16099654]
|
n-(5-methyl-1,2,4-oxadiazol-3-yl)-9h-xanthene-9-carboxamide
|
Cc1nc(NC(=O)C2c3ccccc3Oc3ccccc32)no1
| 44,573,698 | -0.4 | 1 |
InChI=1S/C17H13N3O3/c1-10-18-17(20-23-10)19-16(21)15-11-6-2-4-8-13(11)22-14-9-5-3-7-12(14)15/h2-9,15H,1H3,(H,19,20,21)
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_317
|
chembl1190347
|
4-(4-chlorobenzoyl)-1-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]piperazin-2-one
|
O=C(c1ccc(Cl)cc1)N1CCN(c2ccc(OC3CCN(C4CCC4)CC3)cc2)C(=O)C1
| 15,986,644 | -0.4 | 1 |
InChI=1S/C26H30ClN3O3/c27-20-6-4-19(5-7-20)26(32)29-16-17-30(25(31)18-29)22-8-10-23(11-9-22)33-24-12-14-28(15-13-24)21-2-1-3-21/h4-11,21,24H,1-3,12-18H2
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_324
|
escitalopram
|
(1s)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3h-2-benzofuran-5-carbonitrile
|
CN(C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21
| 146,570 | -0.37 | 1 |
InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_325
|
chembl243571
|
4-[6-hydroxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]-n,n-dimethylbenzenesulfonamide
|
CN(C)S(=O)(=O)c1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1
| 44,427,370 | -0.37 | 1 |
InChI=1S/C31H34N2O5S/c1-32(2)39(35,36)28-14-6-23(7-15-28)29-16-8-24-22-25(34)9-17-30(24)31(29)38-27-12-10-26(11-13-27)37-21-20-33-18-4-3-5-19-33/h6-17,22,34H,3-5,18-21H2,1-2H3
| null |
R47|
|
training
| null | 1 | 2,208 |
B3DB_classification_328
|
mesoridazine
| null |
CC(=O)C1CSc2ccccc2N1CCC1CCCCN1C
| null | -0.36 | 1 |
InChI=1S/C18H26N2OS/c1-14(21)17-13-22-18-9-4-3-8-16(18)20(17)12-10-15-7-5-6-11-19(15)2/h3-4,8-9,15,17H,5-7,10-13H2,1-2H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_329
|
[(2r,9s)-2-carbamoyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl] acetate
|
[(2r,9s)-2-carbamoyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl] acetate
|
CC(=O)O[C@H]1Cc2ccccc2[C@@H](C(N)=O)c2ccccc21
| 29,939,457 | -0.34 | 1 |
InChI=1S/C18H17NO3/c1-11(20)22-16-10-12-6-2-3-7-13(12)17(18(19)21)15-9-5-4-8-14(15)16/h2-9,16-17H,10H2,1H3,(H2,19,21)/t16-,17+/m0/s1
| null |
R8|
|
training
| null | 1 | 2,208 |
B3DB_classification_330
|
schembl11119364
|
5,6-dimethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide
|
CC1c2ccccc2N(C(N)=O)c2ccccc2C1C
| 70,517,986 | -0.34 | 1 |
InChI=1S/C17H18N2O/c1-11-12(2)14-8-4-6-10-16(14)19(17(18)20)15-9-5-3-7-13(11)15/h3-12H,1-2H3,(H2,18,20)
| null |
R2|R2|R8|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_331
|
carbamazepine, 9,10-epoxide
|
3-oxatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide
|
NC(=O)C1c2ccccc2C2OC2c2ccccc21
| 91,751,467 | -0.34 | 1 |
InChI=1S/C16H13NO2/c17-16(18)13-9-5-1-3-7-11(9)14-15(19-14)12-8-4-2-6-10(12)13/h1-8,13-15H,(H2,17,18)
| null |
R2|R2|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_332
|
cbz-epo
|
11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide
|
NC(=O)N1c2ccccc2C2CC2c2ccccc21
| 12,323,381 | -0.34 | 1 |
InChI=1S/C16H14N2O/c17-16(19)18-14-7-3-1-5-10(14)12-9-13(12)11-6-2-4-8-15(11)18/h1-8,12-13H,9H2,(H2,17,19)
| null |
R3|R38|R41|R43|
|
training
| null | 1 | 2,208 |
B3DB_classification_333
| null | null |
NC(=O)[C@H]1c2ccccc2[C@H]2O[C@H]2c2ccccc21
| null | -0.34 | 1 |
InChI=1S/C16H13NO2/c17-16(18)13-9-5-1-3-7-11(9)14-15(19-14)12-8-4-2-6-10(12)13/h1-8,13-15H,(H2,17,18)/t13-,14+,15-
| null |
R48|
|
training
| null | 1 | 2,208 |
B3DB_classification_335
|
risperidone
| null |
Cc1nc2n(c(=O)c1CCN1CCC(c3coc4cc(F)ccc34)CC1)CCCC2
| null | -0.32 | 1 |
InChI=1S/C24H28FN3O2/c1-16-19(24(29)28-10-3-2-4-23(28)26-16)9-13-27-11-7-17(8-12-27)21-15-30-22-14-18(25)5-6-20(21)22/h5-6,14-15,17H,2-4,7-13H2,1H3
| null |
R18|R26|R27|
|
training
| null | 1 | 2,208 |
B3DB_classification_337
|
acetaminophen (p-acetamidophenol)
|
n-(4-hydroxyphenyl)acetamide
|
CC(=O)Nc1ccc(O)cc1
| 1,983 | -0.3 | 1 |
InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)
| null |
R4|R40|R50|R18|R26|R27|R8|R21|R27|R2|R2|R3|R27|R38|R41|R47|R12|R17|R25|R35|R36|R39|R43|R46|R48|R49|R49|R5|R42|R44|
|
training
| null | 1 | 2,208 |
B3DB_classification_338
|
betahistine (y-g 14)
|
n-methyl-2-pyridin-2-ylethanamine
|
CNCCc1ccccn1
| 2,366 | -0.3 | 1 |
InChI=1S/C8H12N2/c1-9-7-5-8-4-2-3-6-10-8/h2-4,6,9H,5,7H2,1H3
| null |
R12|R20|R25|R46|R48|R2|R2|R27|R50|R40|R8|R21|R27|R3|R35|R36|R38|R41|R43|R47|R48|R49|R4|R42|
|
training
| null | 1 | 2,208 |
B3DB_classification_339
|
theophylline
|
1,3-dimethyl-7h-purine-2,6-dione
|
Cn1c(=O)c2[nH]cnc2n(C)c1=O
| 2,153 | -0.3 | 1 |
InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)
| null |
R4|R47|R3|R38|R41|R40|R50|R2|R2|R27|R8|R21|R27|R8|R2|R2|R27|R5|R12|R17|R18|R20|R25|R26|R27|R31|R43|R46|R48|R49|R49|R42|
|
training
| null | 1 | 2,208 |
B3DB_classification_340
|
b-096
|
3-oxa-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide
|
NC(=O)N1c2ccccc2C2OC2c2ccccc21
| 2,555 | -0.3 | 1 |
InChI=1S/C15H12N2O2/c16-15(18)17-11-7-3-1-5-9(11)13-14(19-13)10-6-2-4-8-12(10)17/h1-8,13-14H,(H2,16,18)
| null |
R12|R25|R36|R46|R40|R2|R2|R27|R8|R11|R18|R21|R26|R27|R27|R35|R39|R43|R47|R49|R49|R5|
|
training
| null | 1 | 2,208 |
B3DB_classification_341
|
dichloromethane
|
dichloromethane
|
ClCCl
| 6,344 | -0.3 | 1 |
InChI=1S/CH2Cl2/c2-1-3/h1H2
| null |
R25|R41|R3|R38|R46|R47|R40|R2|R2|R27|R8|R21|R27|R12|R18|R26|R27|R35|R39|R43|R5|
|
training
| null | 1 | 2,208 |
Blood-Brain Barrier Database (B3DB)
The Blood-Brain Barrier Database (B3DB) is a large benchmark dataset compiled from 50 published resources (as summarized at raw_data/raw_data_summary.tsv) and categorized based on the consistency between different experimental references/measurements. This dataset was published in Scientific Data and a mirror of the theochem/B3DB the official Github repo where it is occasionally uploaded with new experimental data. We used the original datasets uploaded in 2023 (regression datasets) and 2021 (classification datasets). Scientists who would like to contribute data should contact the database's maintainers (e.g., by creating a new Issue in the database).
A subset of the molecules in B3DB has numerical logBB values (1058 compounds),
while the whole dataset has categorical (BBB+ or BBB-) BBB permeability labels
(7807 compounds). Some physicochemical properties of the molecules are also provided.
[Updates 2025.08.16 -- version 1.2.0] Removed or replaced the invalid SMILES with valid SMILES.
- Removed 'C[N+]1(C)CCCC@HC1'
- Replaced 'C[N+]1(C)CCCC(OC(=O)C+(c2ccccc2)c2ccccc2)C1' with 'C/N=C(\NC#N)NCCSCc1csc(N=C(N)N)n1'
Quickstart Usage
Load a dataset in python
Each subset can be loaded into python using the Huggingface datasets library.
First, from the command line install the datasets library
$ pip install datasets
then, from within python load the datasets library
>>> import datasets
and load one of the B3DB datasets, e.g.,
>>> B3DB_classification = datasets.load_dataset("maomlab/B3DB", name = "B3DB_classification")
Downloading readme: 100%|ββββββββββββββββββββββββ| 4.40k/4.40k [00:00<00:00, 1.35MB/s]
Downloading data: 100%|ββββββββββββββββββββββββββ| 680k/680k [00:00<00:00, 946kB/s]
Downloading data: 100%|ββββββββββββββββββββββββββ| 2.11M/2.11M [00:01<00:00, 1.28MB/s]
Generating test split: 100%|βββββββββββββββββββββ| 1951/1951 [00:00<00:00, 20854.95 examples/s]
Generating train split: 100%|ββββββββββββββββββββ| 5855/5855 [00:00<00:00, 144260.80 examples/s]
and inspecting the loaded dataset
>>> B3DB_classification
B3DB_classification
DatasetDict({
test: Dataset({
features: ['B3DB_classification_index', 'compound_name', 'IUPAC_name', 'SMILES', 'CID', 'logBB', 'Y', 'Inchi', 'threshold', 'reference', 'group', 'comments', 'ClusterNo', 'MolCount'],
num_rows: 1951
})
train: Dataset({
features: ['B3DB_classification_index', 'compound_name', 'IUPAC_name', 'SMILES', 'CID', 'logBB', 'Y', 'Inchi', 'threshold', 'reference', 'group', 'comments', 'ClusterNo', 'MolCount'],
num_rows: 5855
})
})
Use a dataset to train a model
One way to use the dataset is through the MolFlux package developed by Exscientia.
First, from the command line, install MolFlux library with catboost and rdkit support
pip install 'molflux[catboost,rdkit]'
then load, featurize, split, fit, and evaluate the a catboost model
import json
from datasets import load_dataset
from molflux.datasets import featurise_dataset
from molflux.features import load_from_dicts as load_representations_from_dicts
from molflux.splits import load_from_dict as load_split_from_dict
from molflux.modelzoo import load_from_dict as load_model_from_dict
from molflux.metrics import load_suite
split_dataset = load_dataset('maomlab/B3DB', name = 'B3DB_classification')
split_featurised_dataset = featurise_dataset(
split_dataset,
column = "SMILES",
representations = load_representations_from_dicts([{"name": "morgan"}, {"name": "maccs_rdkit"}]))
model = load_model_from_dict({
"name": "cat_boost_classifier",
"config": {
"x_features": ['SMILES::morgan', 'SMILES::maccs_rdkit'],
"y_features": ['Y']}})
model.train(split_featurised_dataset["train"])
preds = model.predict(split_featurised_dataset["test"])
classification_suite = load_suite("classification")
scores = classification_suite.compute(
references=split_featurised_dataset["test"]['Y'],
predictions=preds["cat_boost_classifier::Y"])
About the DB3B
Features of B3DB
The largest dataset with numerical and categorical values for Blood-Brain Barrier small molecules (to the best of our knowledge, as of February 25, 2021).
Inclusion of stereochemistry information with isomeric SMILES with chiral specifications if available. Otherwise, canonical SMILES are used.
Characterization of uncertainty of experimental measurements by grouping the collected molecular data records.
Extended datasets for numerical and categorical data with precomputed physicochemical properties using mordred.
Data splits
The original B3DB dataset does not define splits, so here we have used the Realistic Split method described
in (Martin et al., 2018).
Citation
Please use the following citation in any publication using our B3DB dataset:
@article{Meng_A_curated_diverse_2021,
author = {Meng, Fanwang and Xi, Yang and Huang, Jinfeng and Ayers, Paul W.},
doi = {10.1038/s41597-021-01069-5},
journal = {Scientific Data},
number = {289},
title = {A curated diverse molecular database of blood-brain barrier permeability with chemical descriptors},
volume = {8},
year = {2021},
url = {https://www.nature.com/articles/s41597-021-01069-5},
publisher = {Springer Nature}
}
- Downloads last month
- 105